List of plants having phytochemicals: 1,2-Benzenedicarboxylic acid, butyl octyl ester
| Sl. No | Plant Name |
|---|---|
| 1 | Dryopteris cochleata |
| 2 | Launaea residifolia |
Details of 1,2-Benzenedicarboxylic acid, butyl octyl ester
| IUPAC | 1-O-butyl 2-O-octyl benzene-1,2-dicarboxylate |
| Canonical Smiles | CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC |
| Inchi | MURWRBWZIMXKGC-UHFFFAOYSA-N |
| PubChem ID | 66540 |
| Smiles | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCC |
| Class | Shikimic acids and derivatives, Simple phenolic acids |
| Super Class | Phenolic acids (C6-C1) |
| Pathways | Shikimates and Phenylpropanoids |