List of plants having phytochemicals: 4-Hydroxybenzaldehyde
| Sl. No | Plant Name |
|---|---|
| 1 | Eleusine coracana |
| 2 | Feronia limonia |
| 3 | Trophis aspera |
Details of 4-Hydroxybenzaldehyde
| IUPAC | 4-hydroxybenzaldehyde |
| Canonical Smiles | O=Cc1ccc(cc1)O |
| Inchi | InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H |
| PubChem ID | 126 |
| Smiles | O=Cc1ccc(O)cc1 |
| Class | Shikimic acids and derivatives, Simple phenolic acids |
| Super Class | Phenolic acids (C6-C1) |
| Pathways | Shikimates and Phenylpropanoids |