List of plants having phytochemicals: Phthalic acid, heptyl octyl ester
| Sl. No | Plant Name |
|---|---|
| 1 | Asystasia gangetica |
Details of Phthalic acid, heptyl octyl ester
| IUPAC | 1-O-heptyl 2-O-octyl benzene-1,2-dicarboxylate |
| Canonical Smiles | CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC |
| Inchi | KFGWBTZKOAMKOT-UHFFFAOYSA-N |
| PubChem ID | 591066 |
| Smiles | CCCC=Cc1ccco1 |
ERROR opening https://cactus.nci.nih.gov/chemical/structure/CCCC%3DCc1ccco1/file?format=sdf&get3d=True -- CCCC%3DCc1ccco1 could not be loaded.
| Class | Shikimic acids and derivatives, Simple phenolic acids |
| Super Class | Phenolic acids (C6-C1) |
| Pathways | Shikimates and Phenylpropanoids |
